C17H27AlCl2N3O3 — CID 176958927
CID 176958927 (PubChem CID 176958927) has the molecular formula C17H27AlCl2N3O3 and a molecular weight of 419.31 g/mol.
| Compound Name | CID 176958927 |
|---|---|
| PubChem CID | 176958927 |
| Molecular Formula | C17H27AlCl2N3O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | — |
| SMILES | COC[C@H](Cc1cc([N+](=O)[O-])ccc1CN(CCCl)CCCl)NC[Al]C |
| InChI | InChI=1S/C16H24Cl2N3O3.CH3.Al/c1-19-15(12-24-2)9-14-10-16(21(22)23)4-3-13(14)11-20(7-5-17)8-6-18;;/h3-4,10,15,19H,1,5-9,11-12H2,2H3;1H3;/t15-;;/m0../s1 |
| InChIKey | QPSATYCWBNEBSW-CKUXDGONSA-N |
| XLogP | 2.73 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|