C23H31N5O3S — CID 176960192
[1-[[4-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methanamine;methanamine (PubChem CID 176960192) has the molecular formula C23H31N5O3S and a molecular weight of 457.60 g/mol. Its IUPAC name is [1-[[4-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methanamine;methanamine.
| Compound Name | [1-[[4-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methanamine;methanamine |
|---|---|
| PubChem CID | 176960192 |
| Molecular Formula | C23H31N5O3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [1-[[4-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methanamine;methanamine |
| SMILES | C=NOc1cc(Cn2cc(CN)cn2)c(OC)cc1Sc1cc(CC)ccc1OC.CN |
| InChI | InChI=1S/C22H26N4O3S.CH5N/c1-5-15-6-7-18(27-3)21(8-15)30-22-10-19(28-4)17(9-20(22)29-24-2)14-26-13-16(11-23)12-25-26;1-2/h6-10,12-13H,2,5,11,14,23H2,1,3-4H3;2H2,1H3 |
| InChIKey | AQEYVHVJJLIZII-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|