C22H24F2N2O3 — CID 176960746
N-[4-[4-(dihydroxymethyl)cyclohexyl]phenyl]-4,6-difluoro-1,3-dihydroisoindole-2-carboxamide (PubChem CID 176960746) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is N-[4-[4-(dihydroxymethyl)cyclohexyl]phenyl]-4,6-difluoro-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[4-[4-(dihydroxymethyl)cyclohexyl]phenyl]-4,6-difluoro-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 176960746 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[4-[4-(dihydroxymethyl)cyclohexyl]phenyl]-4,6-difluoro-1,3-dihydroisoindole-2-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCC(C(O)O)CC2)cc1)N1Cc2cc(F)cc(F)c2C1 |
| InChI | InChI=1S/C22H24F2N2O3/c23-17-9-16-11-26(12-19(16)20(24)10-17)22(29)25-18-7-5-14(6-8-18)13-1-3-15(4-2-13)21(27)28/h5-10,13,15,21,27-28H,1-4,11-12H2,(H,25,29) |
| InChIKey | NXSNSGRDVCRFHZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|