About potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide
potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide (PubChem CID 176964763) has the molecular formula C15H22FKN2-2
and a molecular weight of 288.45 g/mol. Its IUPAC name is potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide.
Molecular Properties
| Compound Name | potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide |
| PubChem CID | 176964763 |
| Molecular Formula | C15H22FKN2-2 |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide |
| SMILES | [CH2-]CC([CH2-])N1CCN(c2ccc(F)cc2)CC1.[CH3-].[K+] |
| InChI | InChI=1S/C14H19FN2.CH3.K/c1-3-12(2)16-8-10-17(11-9-16)14-6-4-13(15)5-7-14;;/h4-7,12H,1-3,8-11H2;1H3;/q-2;-1;+1 |
| InChIKey | ZBNDPRUPPMSLOO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide?
The IUPAC name of potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide (CID 176964763) is potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide.
What is the SMILES notation for potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide?
The canonical SMILES for potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide is [CH2-]CC([CH2-])N1CCN(c2ccc(F)cc2)CC1.[CH3-].[K+].
What is the InChIKey of potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide?
The InChIKey is ZBNDPRUPPMSLOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2.CH3.K/c1-3-12(2)16-8-10-17(11-9-16)14-6-4-13(15)5-7-14;;/h4-7,12H,1-3,8-11H2;1H3;/q-2;-1;+1.
What are the key properties of potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide?
potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide has a molecular weight of 288.45 g/mol, XLogP of -0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-butan-2-yl-4-(4-fluorophenyl)piperazine;carbanide is sourced from PubChem (CID 176964763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).