C21H21N5O4S — CID 176966136
3-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-6-N-(5-ethyl-1H-pyrazol-3-yl)-5-methoxy-1,2-benzoxazole-3,6-diamine (PubChem CID 176966136) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 3-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-6-N-(5-ethyl-1H-pyrazol-3-yl)-5-methoxy-1,2-benzoxazole-3,6-diamine.
| Compound Name | 3-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-6-N-(5-ethyl-1H-pyrazol-3-yl)-5-methoxy-1,2-benzoxazole-3,6-diamine |
|---|---|
| PubChem CID | 176966136 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-6-N-(5-ethyl-1H-pyrazol-3-yl)-5-methoxy-1,2-benzoxazole-3,6-diamine |
| SMILES | CCc1cc(Nc2cc3onc(NSc4ccc5c(c4)OCCO5)c3cc2OC)n[nH]1 |
| InChI | InChI=1S/C21H21N5O4S/c1-3-12-8-20(24-23-12)22-15-11-17-14(10-18(15)27-2)21(25-30-17)26-31-13-4-5-16-19(9-13)29-7-6-28-16/h4-5,8-11H,3,6-7H2,1-2H3,(H,25,26)(H2,22,23,24) |
| InChIKey | GVMDFSNLOCXANC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|