C20H18F3N5O4S — CID 176965987
3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-6-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1,2-benzoxazole-3,6-diamine (PubChem CID 176965987) has the molecular formula C20H18F3N5O4S and a molecular weight of 481.46 g/mol. Its IUPAC name is 3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-6-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1,2-benzoxazole-3,6-diamine.
| Compound Name | 3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-6-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1,2-benzoxazole-3,6-diamine |
|---|---|
| PubChem CID | 176965987 |
| Molecular Formula | C20H18F3N5O4S |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-6-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-1,2-benzoxazole-3,6-diamine |
| SMILES | COc1cc2c(NSc3c(OC)cccc3OC)noc2cc1Nc1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C20H18F3N5O4S/c1-29-12-5-4-6-13(30-2)18(12)33-28-19-10-7-15(31-3)11(8-14(10)32-27-19)24-17-9-16(25-26-17)20(21,22)23/h4-9H,1-3H3,(H,27,28)(H2,24,25,26) |
| InChIKey | FRYCHXFEZOURLO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|