C19H22N2O5S — CID 146288921
N-(2,6-dimethoxyphenyl)sulfanyl-6-(ethoxymethyl)-4-methoxy-1,2-benzoxazol-3-amine (PubChem CID 146288921) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)sulfanyl-6-(ethoxymethyl)-4-methoxy-1,2-benzoxazol-3-amine.
| Compound Name | N-(2,6-dimethoxyphenyl)sulfanyl-6-(ethoxymethyl)-4-methoxy-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146288921 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)sulfanyl-6-(ethoxymethyl)-4-methoxy-1,2-benzoxazol-3-amine |
| SMILES | CCOCc1cc(OC)c2c(NSc3c(OC)cccc3OC)noc2c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-5-25-11-12-9-15(24-4)17-16(10-12)26-20-19(17)21-27-18-13(22-2)7-6-8-14(18)23-3/h6-10H,5,11H2,1-4H3,(H,20,21) |
| InChIKey | BETHIEPNHIGNRN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|