C21H28N4O5S — CID 169217572
N-[2-[[4-methoxy-3-[(2-methoxyphenyl)sulfanylamino]-1,2-benzoxazol-6-yl]methyl-propylamino]ethoxy]hydroxylamine (PubChem CID 169217572) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[2-[[4-methoxy-3-[(2-methoxyphenyl)sulfanylamino]-1,2-benzoxazol-6-yl]methyl-propylamino]ethoxy]hydroxylamine.
| Compound Name | N-[2-[[4-methoxy-3-[(2-methoxyphenyl)sulfanylamino]-1,2-benzoxazol-6-yl]methyl-propylamino]ethoxy]hydroxylamine |
|---|---|
| PubChem CID | 169217572 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-[[4-methoxy-3-[(2-methoxyphenyl)sulfanylamino]-1,2-benzoxazol-6-yl]methyl-propylamino]ethoxy]hydroxylamine |
| SMILES | CCCN(CCONO)Cc1cc(OC)c2c(NSc3ccccc3OC)noc2c1 |
| InChI | InChI=1S/C21H28N4O5S/c1-4-9-25(10-11-29-24-26)14-15-12-17(28-3)20-18(13-15)30-22-21(20)23-31-19-8-6-5-7-16(19)27-2/h5-8,12-13,24,26H,4,9-11,14H2,1-3H3,(H,22,23) |
| InChIKey | DMVQPDNRWYIZFD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|