C22H22N2O4S — CID 177151024
[8-methoxy-3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-6-yl]methanol (PubChem CID 177151024) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is [8-methoxy-3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-6-yl]methanol.
| Compound Name | [8-methoxy-3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-6-yl]methanol |
|---|---|
| PubChem CID | 177151024 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [8-methoxy-3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-6-yl]methanol |
| SMILES | COc1cc(CO)c2c(c1)-c1onc(NSc3ccccc3OC)c1CC21CC1 |
| InChI | InChI=1S/C22H22N2O4S/c1-26-14-9-13(12-25)19-15(10-14)20-16(11-22(19)7-8-22)21(23-28-20)24-29-18-6-4-3-5-17(18)27-2/h3-6,9-10,25H,7-8,11-12H2,1-2H3,(H,23,24) |
| InChIKey | XYCMKQZBKXVQJT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|