C24H25N3O3S — CID 177150814
1-[3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-8-yl]pyrrolidin-3-ol (PubChem CID 177150814) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-8-yl]pyrrolidin-3-ol.
| Compound Name | 1-[3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-8-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 177150814 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[3-[(2-methoxyphenyl)sulfanylamino]spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-8-yl]pyrrolidin-3-ol |
| SMILES | COc1ccccc1SNc1noc2c1CC1(CC1)c1ccc(N3CCC(O)C3)cc1-2 |
| InChI | InChI=1S/C24H25N3O3S/c1-29-20-4-2-3-5-21(20)31-26-23-18-13-24(9-10-24)19-7-6-15(27-11-8-16(28)14-27)12-17(19)22(18)30-25-23/h2-7,12,16,28H,8-11,13-14H2,1H3,(H,25,26) |
| InChIKey | IHGISODFKUBZFX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|