C22H20BrIN2O2S2 — CID 177150869
2-[(8-bromospiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-yl)-(2-methoxyphenyl)sulfanylamino]ethyl thiohypoiodite (PubChem CID 177150869) has the molecular formula C22H20BrIN2O2S2 and a molecular weight of 615.36 g/mol. Its IUPAC name is 2-[(8-bromospiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-yl)-(2-methoxyphenyl)sulfanylamino]ethyl thiohypoiodite.
| Compound Name | 2-[(8-bromospiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-yl)-(2-methoxyphenyl)sulfanylamino]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 177150869 |
| Molecular Formula | C22H20BrIN2O2S2 |
| Molecular Weight | 615.36 g/mol |
| Exact Mass | 613.92 |
| IUPAC Name | 2-[(8-bromospiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-yl)-(2-methoxyphenyl)sulfanylamino]ethyl thiohypoiodite |
| SMILES | COc1ccccc1SN(CCSI)c1noc2c1CC1(CC1)c1ccc(Br)cc1-2 |
| InChI | InChI=1S/C22H20BrIN2O2S2/c1-27-18-4-2-3-5-19(18)30-26(10-11-29-24)21-16-13-22(8-9-22)17-7-6-14(23)12-15(17)20(16)28-25-21/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | VYKZTPOLEQWUHL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.36 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|