C22H26N4O3S — CID 169217303
6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-4-methoxy-N-(2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine (PubChem CID 169217303) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-4-methoxy-N-(2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine.
| Compound Name | 6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-4-methoxy-N-(2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 169217303 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-4-methoxy-N-(2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine |
| SMILES | COc1ccccc1SNc1noc2cc(CN3CC4CNCC4C3)cc(OC)c12 |
| InChI | InChI=1S/C22H26N4O3S/c1-27-17-5-3-4-6-20(17)30-25-22-21-18(28-2)7-14(8-19(21)29-24-22)11-26-12-15-9-23-10-16(15)13-26/h3-8,15-16,23H,9-13H2,1-2H3,(H,24,25) |
| InChIKey | MPIIPXCWZVGMPI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|