C21H23N5O3S — CID 169217374
4-methoxy-N-(2-methoxyphenyl)sulfanyl-6-[[4-(methylaminomethyl)pyrazol-1-yl]methyl]-1,2-benzoxazol-3-amine (PubChem CID 169217374) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyphenyl)sulfanyl-6-[[4-(methylaminomethyl)pyrazol-1-yl]methyl]-1,2-benzoxazol-3-amine.
| Compound Name | 4-methoxy-N-(2-methoxyphenyl)sulfanyl-6-[[4-(methylaminomethyl)pyrazol-1-yl]methyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 169217374 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-methoxy-N-(2-methoxyphenyl)sulfanyl-6-[[4-(methylaminomethyl)pyrazol-1-yl]methyl]-1,2-benzoxazol-3-amine |
| SMILES | CNCc1cnn(Cc2cc(OC)c3c(NSc4ccccc4OC)noc3c2)c1 |
| InChI | InChI=1S/C21H23N5O3S/c1-22-10-15-11-23-26(13-15)12-14-8-17(28-3)20-18(9-14)29-24-21(20)25-30-19-7-5-4-6-16(19)27-2/h4-9,11,13,22H,10,12H2,1-3H3,(H,24,25) |
| InChIKey | HPEWDMLOIKKELA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|