C16H15BrN2O2S — CID 153376407
7-bromo-N-(5-ethyl-2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine (PubChem CID 153376407) has the molecular formula C16H15BrN2O2S and a molecular weight of 379.28 g/mol. Its IUPAC name is 7-bromo-N-(5-ethyl-2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine.
| Compound Name | 7-bromo-N-(5-ethyl-2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 153376407 |
| Molecular Formula | C16H15BrN2O2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 7-bromo-N-(5-ethyl-2-methoxyphenyl)sulfanyl-1,2-benzoxazol-3-amine |
| SMILES | CCc1ccc(OC)c(SNc2noc3c(Br)cccc23)c1 |
| InChI | InChI=1S/C16H15BrN2O2S/c1-3-10-7-8-13(20-2)14(9-10)22-19-16-11-5-4-6-12(17)15(11)21-18-16/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | DMICYXZDFHRNLE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|