C26H34N4O4S3 — CID 176960062
6-[[(Z)-3-(tert-butylsulfanylamino)-2-(methylideneamino)prop-1-enyl]sulfanylmethoxy]-N-(5-ethyl-2-methoxyphenyl)sulfanyl-4-methoxy-1,2-benzoxazol-3-amine (PubChem CID 176960062) has the molecular formula C26H34N4O4S3 and a molecular weight of 562.78 g/mol. Its IUPAC name is 6-[[(Z)-3-(tert-butylsulfanylamino)-2-(methylideneamino)prop-1-enyl]sulfanylmethoxy]-N-(5-ethyl-2-methoxyphenyl)sulfanyl-4-methoxy-1,2-benzoxazol-3-amine.
| Compound Name | 6-[[(Z)-3-(tert-butylsulfanylamino)-2-(methylideneamino)prop-1-enyl]sulfanylmethoxy]-N-(5-ethyl-2-methoxyphenyl)sulfanyl-4-methoxy-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 176960062 |
| Molecular Formula | C26H34N4O4S3 |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 6-[[(Z)-3-(tert-butylsulfanylamino)-2-(methylideneamino)prop-1-enyl]sulfanylmethoxy]-N-(5-ethyl-2-methoxyphenyl)sulfanyl-4-methoxy-1,2-benzoxazol-3-amine |
| SMILES | C=N/C(=C\SCOc1cc(OC)c2c(NSc3cc(CC)ccc3OC)noc2c1)CNSC(C)(C)C |
| InChI | InChI=1S/C26H34N4O4S3/c1-8-17-9-10-20(31-6)23(11-17)36-30-25-24-21(32-7)12-19(13-22(24)34-29-25)33-16-35-15-18(27-5)14-28-37-26(2,3)4/h9-13,15,28H,5,8,14,16H2,1-4,6-7H3,(H,29,30)/b18-15- |
| InChIKey | IEPDFYQXHSYLBK-SDXDJHTJSA-N |
| XLogP | 7.17 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|