C28H33FN6O5S — CID 176960166
N-[[2-[[3-[[2-(2-acetamidoethoxy)-5-ethylphenyl]sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]-1,5-dihydropyrazol-4-yl]methyl]-2-fluoroprop-2-enamide (PubChem CID 176960166) has the molecular formula C28H33FN6O5S and a molecular weight of 584.67 g/mol. Its IUPAC name is N-[[2-[[3-[[2-(2-acetamidoethoxy)-5-ethylphenyl]sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]-1,5-dihydropyrazol-4-yl]methyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[[2-[[3-[[2-(2-acetamidoethoxy)-5-ethylphenyl]sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]-1,5-dihydropyrazol-4-yl]methyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 176960166 |
| Molecular Formula | C28H33FN6O5S |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N-[[2-[[3-[[2-(2-acetamidoethoxy)-5-ethylphenyl]sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]methyl]-1,5-dihydropyrazol-4-yl]methyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)NCC1=CN(Cc2cc(OC)c3c(NSc4cc(CC)ccc4OCCNC(C)=O)noc3c2)NC1 |
| InChI | InChI=1S/C28H33FN6O5S/c1-5-19-6-7-22(39-9-8-30-18(3)36)25(12-19)41-34-27-26-23(38-4)10-20(11-24(26)40-33-27)15-35-16-21(14-32-35)13-31-28(37)17(2)29/h6-7,10-12,16,32H,2,5,8-9,13-15H2,1,3-4H3,(H,30,36)(H,31,37)(H,33,34) |
| InChIKey | GCBVKIAKQFCCHL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|