C28H29FN6O4S — CID 176960105
N-[[1-[[4-[5-ethyl-2-(1H-imidazol-2-ylmethoxy)phenyl]sulfanyl-3-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methyl]-2-fluoroprop-2-enamide (PubChem CID 176960105) has the molecular formula C28H29FN6O4S and a molecular weight of 564.64 g/mol. Its IUPAC name is N-[[1-[[4-[5-ethyl-2-(1H-imidazol-2-ylmethoxy)phenyl]sulfanyl-3-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[[1-[[4-[5-ethyl-2-(1H-imidazol-2-ylmethoxy)phenyl]sulfanyl-3-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 176960105 |
| Molecular Formula | C28H29FN6O4S |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | N-[[1-[[4-[5-ethyl-2-(1H-imidazol-2-ylmethoxy)phenyl]sulfanyl-3-methoxy-5-(methylideneamino)oxyphenyl]methyl]pyrazol-4-yl]methyl]-2-fluoroprop-2-enamide |
| SMILES | C=NOc1cc(Cn2cc(CNC(=O)C(=C)F)cn2)cc(OC)c1Sc1cc(CC)ccc1OCc1ncc[nH]1 |
| InChI | InChI=1S/C28H29FN6O4S/c1-5-19-6-7-22(38-17-26-31-8-9-32-26)25(12-19)40-27-23(37-4)10-20(11-24(27)39-30-3)15-35-16-21(14-34-35)13-33-28(36)18(2)29/h6-12,14,16H,2-3,5,13,15,17H2,1,4H3,(H,31,32)(H,33,36) |
| InChIKey | KBELOSJOSLECIX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|