C25H24N4O5S2 — CID 176960100
N-[[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]oxy]-1,3-thiazol-5-yl]methyl]but-2-ynamide (PubChem CID 176960100) has the molecular formula C25H24N4O5S2 and a molecular weight of 524.62 g/mol. Its IUPAC name is N-[[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]oxy]-1,3-thiazol-5-yl]methyl]but-2-ynamide.
| Compound Name | N-[[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]oxy]-1,3-thiazol-5-yl]methyl]but-2-ynamide |
|---|---|
| PubChem CID | 176960100 |
| Molecular Formula | C25H24N4O5S2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-[[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfanylamino]-4-methoxy-1,2-benzoxazol-6-yl]oxy]-1,3-thiazol-5-yl]methyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCc1cnc(Oc2cc(OC)c3c(NSc4cc(CC)ccc4OC)noc3c2)s1 |
| InChI | InChI=1S/C25H24N4O5S2/c1-5-7-22(30)26-13-17-14-27-25(35-17)33-16-11-19(32-4)23-20(12-16)34-28-24(23)29-36-21-10-15(6-2)8-9-18(21)31-3/h8-12,14H,6,13H2,1-4H3,(H,26,30)(H,28,29) |
| InChIKey | PRMOYDHONJKKSZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|