C21H19ClN4O4S — CID 168942398
4-[(4-chloropyrazol-1-yl)methyl]-N-(2,6-dimethoxyphenyl)sulfanyl-2,3-dihydrofuro[2,3-e][1,2]benzoxazol-8-amine (PubChem CID 168942398) has the molecular formula C21H19ClN4O4S and a molecular weight of 458.93 g/mol. Its IUPAC name is 4-[(4-chloropyrazol-1-yl)methyl]-N-(2,6-dimethoxyphenyl)sulfanyl-2,3-dihydrofuro[2,3-e][1,2]benzoxazol-8-amine.
| Compound Name | 4-[(4-chloropyrazol-1-yl)methyl]-N-(2,6-dimethoxyphenyl)sulfanyl-2,3-dihydrofuro[2,3-e][1,2]benzoxazol-8-amine |
|---|---|
| PubChem CID | 168942398 |
| Molecular Formula | C21H19ClN4O4S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4-[(4-chloropyrazol-1-yl)methyl]-N-(2,6-dimethoxyphenyl)sulfanyl-2,3-dihydrofuro[2,3-e][1,2]benzoxazol-8-amine |
| SMILES | COc1cccc(OC)c1SNc1noc2cc(Cn3cc(Cl)cn3)c3c(c12)OCC3 |
| InChI | InChI=1S/C21H19ClN4O4S/c1-27-15-4-3-5-16(28-2)20(15)31-25-21-18-17(30-24-21)8-12(14-6-7-29-19(14)18)10-26-11-13(22)9-23-26/h3-5,8-9,11H,6-7,10H2,1-2H3,(H,24,25) |
| InChIKey | BATBWJRZYPOABA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|