C21H30N4 — CID 176966947
5-[1-[ethyl(methyl)amino]ethenyl]-N-(3-ethyl-4-propylphenyl)-4-methylpyrimidin-2-amine (PubChem CID 176966947) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 5-[1-[ethyl(methyl)amino]ethenyl]-N-(3-ethyl-4-propylphenyl)-4-methylpyrimidin-2-amine.
| Compound Name | 5-[1-[ethyl(methyl)amino]ethenyl]-N-(3-ethyl-4-propylphenyl)-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 176966947 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 5-[1-[ethyl(methyl)amino]ethenyl]-N-(3-ethyl-4-propylphenyl)-4-methylpyrimidin-2-amine |
| SMILES | C=C(c1cnc(Nc2ccc(CCC)c(CC)c2)nc1C)N(C)CC |
| InChI | InChI=1S/C21H30N4/c1-7-10-18-11-12-19(13-17(18)8-2)24-21-22-14-20(15(4)23-21)16(5)25(6)9-3/h11-14H,5,7-10H2,1-4,6H3,(H,22,23,24) |
| InChIKey | HBPUEMKGKDSPCA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |