C14H19NO3 — CID 176969003
5-(2-ethyl-3-pyridinyl)-2,2-dimethyl-5-oxopentanoic acid (PubChem CID 176969003) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-(2-ethyl-3-pyridinyl)-2,2-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(2-ethyl-3-pyridinyl)-2,2-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 176969003 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 5-(2-ethyl-3-pyridinyl)-2,2-dimethyl-5-oxopentanoic acid |
| SMILES | CCc1ncccc1C(=O)CCC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H19NO3/c1-4-11-10(6-5-9-15-11)12(16)7-8-14(2,3)13(17)18/h5-6,9H,4,7-8H2,1-3H3,(H,17,18) |
| InChIKey | UFUUQNDZLFCORO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |