C17H16N2O4 — CID 176969044
N-methoxy-5-(1-methoxynaphthalen-2-yl)-N-methyl-1,2-oxazole-3-carboxamide (PubChem CID 176969044) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-methoxy-5-(1-methoxynaphthalen-2-yl)-N-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-methoxy-5-(1-methoxynaphthalen-2-yl)-N-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 176969044 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-methoxy-5-(1-methoxynaphthalen-2-yl)-N-methyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1c(-c2cc(C(=O)N(C)OC)no2)ccc2ccccc12 |
| InChI | InChI=1S/C17H16N2O4/c1-19(22-3)17(20)14-10-15(23-18-14)13-9-8-11-6-4-5-7-12(11)16(13)21-2/h4-10H,1-3H3 |
| InChIKey | VQUYNQVMGQXTAF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|