C16H25FO — CID 176969057
(6Z,7Z,9E)-6-ethylidene-9-fluoro-5-propylundeca-7,9-dien-3-one (PubChem CID 176969057) has the molecular formula C16H25FO and a molecular weight of 252.37 g/mol. Its IUPAC name is (6Z,7Z,9E)-6-ethylidene-9-fluoro-5-propylundeca-7,9-dien-3-one.
| Compound Name | (6Z,7Z,9E)-6-ethylidene-9-fluoro-5-propylundeca-7,9-dien-3-one |
|---|---|
| PubChem CID | 176969057 |
| Molecular Formula | C16H25FO |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (6Z,7Z,9E)-6-ethylidene-9-fluoro-5-propylundeca-7,9-dien-3-one |
| SMILES | C/C=C(\C=C/C(F)=C\C)C(CCC)CC(=O)CC |
| InChI | InChI=1S/C16H25FO/c1-5-9-14(12-16(18)8-4)13(6-2)10-11-15(17)7-3/h6-7,10-11,14H,5,8-9,12H2,1-4H3/b11-10-,13-6+,15-7+ |
| InChIKey | VNIMUNUOAGLQOS-KKMBRQIYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|