C12H23N — CID 130217220
(Z,4Z)-5-ethyl-4-ethylideneoct-2-en-1-amine (PubChem CID 130217220) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (Z,4Z)-5-ethyl-4-ethylideneoct-2-en-1-amine.
| Compound Name | (Z,4Z)-5-ethyl-4-ethylideneoct-2-en-1-amine |
|---|---|
| PubChem CID | 130217220 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (Z,4Z)-5-ethyl-4-ethylideneoct-2-en-1-amine |
| SMILES | C/C=C(\C=C/CN)C(CC)CCC |
| InChI | InChI=1S/C12H23N/c1-4-8-11(5-2)12(6-3)9-7-10-13/h6-7,9,11H,4-5,8,10,13H2,1-3H3/b9-7-,12-6+ |
| InChIKey | WFKXFWRXFRRBCR-GIFINZEMSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|