C16H28S — CID 138498137
(2E,4Z,6E)-7-propyl-6-propylidenedeca-2,4-diene-3-thiol (PubChem CID 138498137) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is (2E,4Z,6E)-7-propyl-6-propylidenedeca-2,4-diene-3-thiol.
| Compound Name | (2E,4Z,6E)-7-propyl-6-propylidenedeca-2,4-diene-3-thiol |
|---|---|
| PubChem CID | 138498137 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (2E,4Z,6E)-7-propyl-6-propylidenedeca-2,4-diene-3-thiol |
| SMILES | C/C=C(S)\C=C/C(=C/CC)C(CCC)CCC |
| InChI | InChI=1S/C16H28S/c1-5-9-14(10-6-2)15(11-7-3)12-13-16(17)8-4/h8,11-14,17H,5-7,9-10H2,1-4H3/b13-12-,15-11-,16-8+ |
| InChIKey | YCJSAWMSKJDTLR-UNZYHWDRSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|