C15H18ClF2N5O2 — CID 176974415
4-amino-7-chloro-8-fluoro-2-methoxy-6H-pyrido[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 176974415) has the molecular formula C15H18ClF2N5O2 and a molecular weight of 373.79 g/mol. Its IUPAC name is 4-amino-7-chloro-8-fluoro-2-methoxy-6H-pyrido[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 4-amino-7-chloro-8-fluoro-2-methoxy-6H-pyrido[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 176974415 |
| Molecular Formula | C15H18ClF2N5O2 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-amino-7-chloro-8-fluoro-2-methoxy-6H-pyrido[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | COc1nc(N)c2c(=O)[nH]c(Cl)c(F)c2n1.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C8H6ClFN4O2.C7H12FN/c1-16-8-12-4-2(6(11)14-8)7(15)13-5(9)3(4)10;8-6-4-7-2-1-3-9(7)5-6/h1H3,(H,13,15)(H2,11,12,14);6-7H,1-5H2 |
| InChIKey | FCEOFCFEFHBBHZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|