C17H20ClF2N5O2 — CID 176974824
7-chloro-4-(ethylamino)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 176974824) has the molecular formula C17H20ClF2N5O2 and a molecular weight of 399.83 g/mol. Its IUPAC name is 7-chloro-4-(ethylamino)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 7-chloro-4-(ethylamino)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 176974824 |
| Molecular Formula | C17H20ClF2N5O2 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 7-chloro-4-(ethylamino)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCNc1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc2c(F)c(Cl)[nH]c(=O)c12 |
| InChI | InChI=1S/C17H20ClF2N5O2/c1-2-21-14-10-12(11(20)13(18)23-15(10)26)22-16(24-14)27-8-17-4-3-5-25(17)7-9(19)6-17/h9H,2-8H2,1H3,(H,23,26)(H,21,22,24)/t9-,17+/m1/s1 |
| InChIKey | YFEFWVJPLLPIKT-XLFHBGCDSA-N |
| XLogP | 2.50 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|