C17H19BN6O7 — CID 176978006
CID 176978006 (PubChem CID 176978006) has the molecular formula C17H19BN6O7 and a molecular weight of 430.19 g/mol.
| Compound Name | CID 176978006 |
|---|---|
| PubChem CID | 176978006 |
| Molecular Formula | C17H19BN6O7 |
| Molecular Weight | 430.19 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | — |
| SMILES | CC#N.[B]C1(O)C(Cn2cc(-c3ncnc4[nH]ccc34)cn2)C(O)(O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C15H16BN5O7.C2H3N/c16-12(22)9(13(23,24)15(27,28)14(12,25)26)5-21-4-7(3-20-21)10-8-1-2-17-11(8)19-6-18-10;1-2-3/h1-4,6,9,22-28H,5H2,(H,17,18,19);1H3 |
| InChIKey | VVUGJAXTVYPGRC-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 224.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.19 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|