C16H23N4O9P — CID 176979583
3-[[2-[dihydroxyphosphanyloxymethoxycarbonyl-[[2-[formyl(methyl)amino]-3-pyridinyl]methyl]amino]acetyl]amino]butanoic acid (PubChem CID 176979583) has the molecular formula C16H23N4O9P and a molecular weight of 446.35 g/mol. Its IUPAC name is 3-[[2-[dihydroxyphosphanyloxymethoxycarbonyl-[[2-[formyl(methyl)amino]-3-pyridinyl]methyl]amino]acetyl]amino]butanoic acid.
| Compound Name | 3-[[2-[dihydroxyphosphanyloxymethoxycarbonyl-[[2-[formyl(methyl)amino]-3-pyridinyl]methyl]amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 176979583 |
| Molecular Formula | C16H23N4O9P |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-[[2-[dihydroxyphosphanyloxymethoxycarbonyl-[[2-[formyl(methyl)amino]-3-pyridinyl]methyl]amino]acetyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CN(Cc1cccnc1N(C)C=O)C(=O)OCOP(O)O |
| InChI | InChI=1S/C16H23N4O9P/c1-11(6-14(23)24)18-13(22)8-20(16(25)28-10-29-30(26)27)7-12-4-3-5-17-15(12)19(2)9-21/h3-5,9,11,26-27H,6-8,10H2,1-2H3,(H,18,22)(H,23,24) |
| InChIKey | YQMGRZVVTHLVEP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 178.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|