C20H24N8O3S — CID 176980335
methyl 4-[3-[3-cyano-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]sulfanyl-6-oxo-1H-pyridin-4-yl]phenyl]piperazine-1-carboxylate (PubChem CID 176980335) has the molecular formula C20H24N8O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is methyl 4-[3-[3-cyano-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]sulfanyl-6-oxo-1H-pyridin-4-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[3-[3-cyano-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]sulfanyl-6-oxo-1H-pyridin-4-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176980335 |
| Molecular Formula | C20H24N8O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | methyl 4-[3-[3-cyano-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]sulfanyl-6-oxo-1H-pyridin-4-yl]phenyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2cccc(-c3cc(=O)[nH]c(SC/C(=N/N)NN)c3C#N)c2)CC1 |
| InChI | InChI=1S/C20H24N8O3S/c1-31-20(30)28-7-5-27(6-8-28)14-4-2-3-13(9-14)15-10-18(29)24-19(16(15)11-21)32-12-17(25-22)26-23/h2-4,9-10H,5-8,12,22-23H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | ZBLXWDXOTLYTCB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|