C25H28N4O6 — CID 176980915
3-[(3S)-3-[[4-[(3-acetyl-2-methylphenyl)carbamoylamino]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3-oxopropanoic acid (PubChem CID 176980915) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-[(3S)-3-[[4-[(3-acetyl-2-methylphenyl)carbamoylamino]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(3S)-3-[[4-[(3-acetyl-2-methylphenyl)carbamoylamino]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 176980915 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[(3S)-3-[[4-[(3-acetyl-2-methylphenyl)carbamoylamino]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3-oxopropanoic acid |
| SMILES | CC(=O)c1cccc(NC(=O)Nc2ccc(CNC(=O)[C@H]3CCN(C(=O)CC(=O)O)C3)cc2)c1C |
| InChI | InChI=1S/C25H28N4O6/c1-15-20(16(2)30)4-3-5-21(15)28-25(35)27-19-8-6-17(7-9-19)13-26-24(34)18-10-11-29(14-18)22(31)12-23(32)33/h3-9,18H,10-14H2,1-2H3,(H,26,34)(H,32,33)(H2,27,28,35)/t18-/m0/s1 |
| InChIKey | WREOBKCOPQHZOC-SFHVURJKSA-N |
| XLogP | 2.78 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|