C12H21NO — CID 176984722
N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylpentanamide (PubChem CID 176984722) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylpentanamide.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylpentanamide |
|---|---|
| PubChem CID | 176984722 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylpentanamide |
| SMILES | C/C=C\C(=C/C)NC(=O)C(C)CCC |
| InChI | InChI=1S/C12H21NO/c1-5-8-10(4)12(14)13-11(7-3)9-6-2/h6-7,9-10H,5,8H2,1-4H3,(H,13,14)/b9-6-,11-7+ |
| InChIKey | LOEFHWDNQVORDL-STGKXFFCSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|