C22H23FN2O3S — CID 176987763
5-[3-(4-azadispiro[2.1.25.33]decan-9-ylamino)phenyl]-4-fluoro-3-(2-oxoethoxy)thiophene-2-carbaldehyde (PubChem CID 176987763) has the molecular formula C22H23FN2O3S and a molecular weight of 414.50 g/mol. Its IUPAC name is 5-[3-(4-azadispiro[2.1.25.33]decan-9-ylamino)phenyl]-4-fluoro-3-(2-oxoethoxy)thiophene-2-carbaldehyde.
| Compound Name | 5-[3-(4-azadispiro[2.1.25.33]decan-9-ylamino)phenyl]-4-fluoro-3-(2-oxoethoxy)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 176987763 |
| Molecular Formula | C22H23FN2O3S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[3-(4-azadispiro[2.1.25.33]decan-9-ylamino)phenyl]-4-fluoro-3-(2-oxoethoxy)thiophene-2-carbaldehyde |
| SMILES | O=CCOc1c(C=O)sc(-c2cccc(NC3CC4(CC4)NC4(CC4)C3)c2)c1F |
| InChI | InChI=1S/C22H23FN2O3S/c23-18-19(28-9-8-26)17(13-27)29-20(18)14-2-1-3-15(10-14)24-16-11-21(4-5-21)25-22(12-16)6-7-22/h1-3,8,10,13,16,24-25H,4-7,9,11-12H2 |
| InChIKey | SMCCRRWOELWVMP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|