C33H36N4O2 — CID 176988246
2-[6-[1-(6-ethylindolizin-2-yl)piperidin-4-yl]-2-oxobenzo[cd]indol-1-yl]-N-methylhex-5-enamide (PubChem CID 176988246) has the molecular formula C33H36N4O2 and a molecular weight of 520.68 g/mol. Its IUPAC name is 2-[6-[1-(6-ethylindolizin-2-yl)piperidin-4-yl]-2-oxobenzo[cd]indol-1-yl]-N-methylhex-5-enamide.
| Compound Name | 2-[6-[1-(6-ethylindolizin-2-yl)piperidin-4-yl]-2-oxobenzo[cd]indol-1-yl]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 176988246 |
| Molecular Formula | C33H36N4O2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 2-[6-[1-(6-ethylindolizin-2-yl)piperidin-4-yl]-2-oxobenzo[cd]indol-1-yl]-N-methylhex-5-enamide |
| SMILES | C=CCCC(C(=O)NC)N1C(=O)c2cccc3c(C4CCN(c5cc6ccc(CC)cn6c5)CC4)ccc1c23 |
| InChI | InChI=1S/C33H36N4O2/c1-4-6-10-30(32(38)34-3)37-29-14-13-26(27-8-7-9-28(31(27)29)33(37)39)23-15-17-35(18-16-23)25-19-24-12-11-22(5-2)20-36(24)21-25/h4,7-9,11-14,19-21,23,30H,1,5-6,10,15-18H2,2-3H3,(H,34,38) |
| InChIKey | YXIJVHGLQGMITD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|