C33H38N4O3 — CID 155207725
4-[6-[[4-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]-N-formylpentanamide (PubChem CID 155207725) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is 4-[6-[[4-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]-N-formylpentanamide.
| Compound Name | 4-[6-[[4-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]-N-formylpentanamide |
|---|---|
| PubChem CID | 155207725 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 4-[6-[[4-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]-N-formylpentanamide |
| SMILES | CC(CCC(=O)NC=O)N1C(=O)c2cccc3c(Cc4ccc(CN5CCN(CC6CC6)CC5)cc4)ccc1c23 |
| InChI | InChI=1S/C33H38N4O3/c1-23(5-14-31(39)34-22-38)37-30-13-12-27(28-3-2-4-29(32(28)30)33(37)40)19-24-6-8-25(9-7-24)20-35-15-17-36(18-16-35)21-26-10-11-26/h2-4,6-9,12-13,22-23,26H,5,10-11,14-21H2,1H3,(H,34,38,39) |
| InChIKey | CUMVFKTWEHGDSN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|