C32H37N5O4S — CID 163258925
N-formyl-4-[7-[1-[(3-morpholin-4-ylsulfanylphenyl)methyl]piperidin-4-yl]-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]pentanamide (PubChem CID 163258925) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is N-formyl-4-[7-[1-[(3-morpholin-4-ylsulfanylphenyl)methyl]piperidin-4-yl]-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]pentanamide.
| Compound Name | N-formyl-4-[7-[1-[(3-morpholin-4-ylsulfanylphenyl)methyl]piperidin-4-yl]-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]pentanamide |
|---|---|
| PubChem CID | 163258925 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | N-formyl-4-[7-[1-[(3-morpholin-4-ylsulfanylphenyl)methyl]piperidin-4-yl]-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]pentanamide |
| SMILES | CC(CCC(=O)NC=O)N1C(=O)c2ccc(C3CCN(Cc4cccc(SN5CCOCC5)c4)CC3)c3nccc1c23 |
| InChI | InChI=1S/C32H37N5O4S/c1-22(5-8-29(39)34-21-38)37-28-9-12-33-31-26(6-7-27(30(28)31)32(37)40)24-10-13-35(14-11-24)20-23-3-2-4-25(19-23)42-36-15-17-41-18-16-36/h2-4,6-7,9,12,19,21-22,24H,5,8,10-11,13-18,20H2,1H3,(H,34,38,39) |
| InChIKey | CMRWPIFVFGCYGK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|