C11H10F3NO — CID 176990281
5-(4-methoxybuta-2,3-dien-2-yl)-2-(trifluoromethyl)pyridine (PubChem CID 176990281) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 5-(4-methoxybuta-2,3-dien-2-yl)-2-(trifluoromethyl)pyridine.
| Compound Name | 5-(4-methoxybuta-2,3-dien-2-yl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 176990281 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 5-(4-methoxybuta-2,3-dien-2-yl)-2-(trifluoromethyl)pyridine |
| SMILES | COC=C=C(C)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H10F3NO/c1-8(5-6-16-2)9-3-4-10(15-7-9)11(12,13)14/h3-4,6-7H,1-2H3 |
| InChIKey | KECOVPPDFMPLJN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|