C26H24B3FN6O3 — CID 176994092
CID 176994092 (PubChem CID 176994092) has the molecular formula C26H24B3FN6O3 and a molecular weight of 519.95 g/mol.
| Compound Name | CID 176994092 |
|---|---|
| PubChem CID | 176994092 |
| Molecular Formula | C26H24B3FN6O3 |
| Molecular Weight | 519.95 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1cc2c(Oc3ccc(CC(=O)Nc4cnn(C(C)(C)C)c4)nc3C)ccnc2cc1F |
| InChI | InChI=1S/C26H24B3FN6O3/c1-14-21(6-5-15(33-14)9-23(37)34-16-12-32-36(13-16)25(2,3)4)39-22-7-8-31-20-11-19(30)17(10-18(20)22)24(38)35-26(27,28)29/h5-8,10-13H,9H2,1-4H3,(H,34,37)(H,35,38) |
| InChIKey | HIPBZKJAGDFJRC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|