C20H16B3FN2O2 — CID 176994101
CID 176994101 (PubChem CID 176994101) has the molecular formula C20H16B3FN2O2 and a molecular weight of 367.79 g/mol.
| Compound Name | CID 176994101 |
|---|---|
| PubChem CID | 176994101 |
| Molecular Formula | C20H16B3FN2O2 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1cc2c(Oc3ccc(CC)cc3C)ccnc2cc1F |
| InChI | InChI=1S/C20H16B3FN2O2/c1-3-12-4-5-17(11(2)8-12)28-18-6-7-25-16-10-15(24)13(9-14(16)18)19(27)26-20(21,22)23/h4-10H,3H2,1-2H3,(H,26,27) |
| InChIKey | PMFRLMCMXDTVAF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|