C28H33F2N5O6 — CID 176994106
N-[(E)-1-amino-3-tert-butyliminoprop-1-en-2-yl]formamide;4-(4-ethyl-2-fluoro-6-methylphenoxy)-7-fluoro-N-(trihydroxymethyl)quinoline-6-carboxamide (PubChem CID 176994106) has the molecular formula C28H33F2N5O6 and a molecular weight of 573.60 g/mol. Its IUPAC name is N-[(E)-1-amino-3-tert-butyliminoprop-1-en-2-yl]formamide;4-(4-ethyl-2-fluoro-6-methylphenoxy)-7-fluoro-N-(trihydroxymethyl)quinoline-6-carboxamide.
| Compound Name | N-[(E)-1-amino-3-tert-butyliminoprop-1-en-2-yl]formamide;4-(4-ethyl-2-fluoro-6-methylphenoxy)-7-fluoro-N-(trihydroxymethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 176994106 |
| Molecular Formula | C28H33F2N5O6 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | N-[(E)-1-amino-3-tert-butyliminoprop-1-en-2-yl]formamide;4-(4-ethyl-2-fluoro-6-methylphenoxy)-7-fluoro-N-(trihydroxymethyl)quinoline-6-carboxamide |
| SMILES | CC(C)(C)/N=C/C(=C\N)NC=O.CCc1cc(C)c(Oc2ccnc3cc(F)c(C(=O)NC(O)(O)O)cc23)c(F)c1 |
| InChI | InChI=1S/C20H18F2N2O5.C8H15N3O/c1-3-11-6-10(2)18(15(22)7-11)29-17-4-5-23-16-9-14(21)12(8-13(16)17)19(25)24-20(26,27)28;1-8(2,3)11-5-7(4-9)10-6-12/h4-9,26-28H,3H2,1-2H3,(H,24,25);4-6H,9H2,1-3H3,(H,10,12)/b;7-4+,11-5+ |
| InChIKey | PJGKHDMIFRIPHL-HIZNKOGOSA-N |
| XLogP | 2.90 |
| TPSA | 179.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|