C31H18ClNO — CID 176994569
4-chloro-2-dibenzofuran-3-yl-6-(4-phenylphenyl)benzonitrile (PubChem CID 176994569) has the molecular formula C31H18ClNO and a molecular weight of 455.94 g/mol. Its IUPAC name is 4-chloro-2-dibenzofuran-3-yl-6-(4-phenylphenyl)benzonitrile.
| Compound Name | 4-chloro-2-dibenzofuran-3-yl-6-(4-phenylphenyl)benzonitrile |
|---|---|
| PubChem CID | 176994569 |
| Molecular Formula | C31H18ClNO |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-chloro-2-dibenzofuran-3-yl-6-(4-phenylphenyl)benzonitrile |
| SMILES | N#Cc1c(-c2ccc(-c3ccccc3)cc2)cc(Cl)cc1-c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C31H18ClNO/c32-24-17-27(22-12-10-21(11-13-22)20-6-2-1-3-7-20)29(19-33)28(18-24)23-14-15-26-25-8-4-5-9-30(25)34-31(26)16-23/h1-18H |
| InChIKey | FHOUZJLOLBMFCU-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |