C22H33N4P — CID 176994901
(Z)-1-[amino(butyl)amino]-4-[3-[(benzylamino)-phosphanylmethyl]phenyl]but-1-en-2-amine (PubChem CID 176994901) has the molecular formula C22H33N4P and a molecular weight of 384.51 g/mol. Its IUPAC name is (Z)-1-[amino(butyl)amino]-4-[3-[(benzylamino)-phosphanylmethyl]phenyl]but-1-en-2-amine.
| Compound Name | (Z)-1-[amino(butyl)amino]-4-[3-[(benzylamino)-phosphanylmethyl]phenyl]but-1-en-2-amine |
|---|---|
| PubChem CID | 176994901 |
| Molecular Formula | C22H33N4P |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (Z)-1-[amino(butyl)amino]-4-[3-[(benzylamino)-phosphanylmethyl]phenyl]but-1-en-2-amine |
| SMILES | CCCCN(N)/C=C(\N)CCc1cccc(C(P)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H33N4P/c1-2-3-14-26(24)17-21(23)13-12-18-10-7-11-20(15-18)22(27)25-16-19-8-5-4-6-9-19/h4-11,15,17,22,25H,2-3,12-14,16,23-24,27H2,1H3/b21-17- |
| InChIKey | PDJVDPZFQUFNIT-FXBPSFAMSA-N |
| XLogP | 4.06 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|