About (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene
(Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene (PubChem CID 145271170) has the molecular formula C15H33N3
and a molecular weight of 255.45 g/mol. Its IUPAC name is (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene.
Molecular Properties
| Compound Name | (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene |
| PubChem CID | 145271170 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene |
| SMILES | C=C.CCCCCC/C(N)=C/N(N)CCCCC |
| InChI | InChI=1S/C13H29N3.C2H4/c1-3-5-7-8-10-13(14)12-16(15)11-9-6-4-2;1-2/h12H,3-11,14-15H2,1-2H3;1-2H2/b13-12-; |
| InChIKey | SQQRLSSZAHFROI-USGGBSEESA-N |
| XLogP | 3.92 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene?
The IUPAC name of (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene (CID 145271170) is (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene.
What is the SMILES notation for (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene?
The canonical SMILES for (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene is C=C.CCCCCC/C(N)=C/N(N)CCCCC.
What is the InChIKey of (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene?
The InChIKey is SQQRLSSZAHFROI-USGGBSEESA-N. The full InChI is InChI=1S/C13H29N3.C2H4/c1-3-5-7-8-10-13(14)12-16(15)11-9-6-4-2;1-2/h12H,3-11,14-15H2,1-2H3;1-2H2/b13-12-;.
What are the key properties of (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene?
(Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene has a molecular weight of 255.45 g/mol, XLogP of 3.92, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[amino(pentyl)amino]oct-1-en-2-amine;ethene is sourced from PubChem (CID 145271170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).