C25H50N4O — CID 177012712
(Z)-4-[amino-(6-cyclobutylidene-6-undecan-6-yloxyhexyl)amino]but-3-ene-1,3-diamine (PubChem CID 177012712) has the molecular formula C25H50N4O and a molecular weight of 422.70 g/mol. Its IUPAC name is (Z)-4-[amino-(6-cyclobutylidene-6-undecan-6-yloxyhexyl)amino]but-3-ene-1,3-diamine.
| Compound Name | (Z)-4-[amino-(6-cyclobutylidene-6-undecan-6-yloxyhexyl)amino]but-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 177012712 |
| Molecular Formula | C25H50N4O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.40 |
| IUPAC Name | (Z)-4-[amino-(6-cyclobutylidene-6-undecan-6-yloxyhexyl)amino]but-3-ene-1,3-diamine |
| SMILES | CCCCCC(CCCCC)OC(CCCCCN(N)/C=C(\N)CCN)=C1CCC1 |
| InChI | InChI=1S/C25H50N4O/c1-3-5-8-15-24(16-9-6-4-2)30-25(22-13-12-14-22)17-10-7-11-20-29(28)21-23(27)18-19-26/h21,24H,3-20,26-28H2,1-2H3/b23-21- |
| InChIKey | KLAAIZVBUWXOBA-LNVKXUELSA-N |
| XLogP | 5.86 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|