C20H29N4OP — CID 176995243
(Z)-1-[amino(propyl)amino]-3-[4-[(benzylamino)-phosphanylmethyl]phenoxy]prop-1-en-2-amine (PubChem CID 176995243) has the molecular formula C20H29N4OP and a molecular weight of 372.45 g/mol. Its IUPAC name is (Z)-1-[amino(propyl)amino]-3-[4-[(benzylamino)-phosphanylmethyl]phenoxy]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(propyl)amino]-3-[4-[(benzylamino)-phosphanylmethyl]phenoxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 176995243 |
| Molecular Formula | C20H29N4OP |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (Z)-1-[amino(propyl)amino]-3-[4-[(benzylamino)-phosphanylmethyl]phenoxy]prop-1-en-2-amine |
| SMILES | CCCN(N)/C=C(\N)COc1ccc(C(P)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H29N4OP/c1-2-12-24(22)14-18(21)15-25-19-10-8-17(9-11-19)20(26)23-13-16-6-4-3-5-7-16/h3-11,14,20,23H,2,12-13,15,21-22,26H2,1H3/b18-14- |
| InChIKey | GUBNFOIBUTUMIO-JXAWBTAJSA-N |
| XLogP | 3.11 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|