C19H35N3O8S — CID 176995551
5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[(2S)-1-(2,3-dihydroxypropoxy)-2,3-dihydroxypropoxy]propyl]pentanamide (PubChem CID 176995551) has the molecular formula C19H35N3O8S and a molecular weight of 465.57 g/mol. Its IUPAC name is 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[(2S)-1-(2,3-dihydroxypropoxy)-2,3-dihydroxypropoxy]propyl]pentanamide.
| Compound Name | 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[(2S)-1-(2,3-dihydroxypropoxy)-2,3-dihydroxypropoxy]propyl]pentanamide |
|---|---|
| PubChem CID | 176995551 |
| Molecular Formula | C19H35N3O8S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[(2S)-1-(2,3-dihydroxypropoxy)-2,3-dihydroxypropoxy]propyl]pentanamide |
| SMILES | O=C(CCCCC1SC[C@@H]2NC(=O)N[C@H]12)NCCCOC(OCC(O)CO)[C@@H](O)CO |
| InChI | InChI=1S/C19H35N3O8S/c23-8-12(25)10-30-18(14(26)9-24)29-7-3-6-20-16(27)5-2-1-4-15-17-13(11-31-15)21-19(28)22-17/h12-15,17-18,23-26H,1-11H2,(H,20,27)(H2,21,22,28)/t12?,13-,14-,15?,17-,18?/m0/s1 |
| InChIKey | FZFWLXMZJRNNLY-LEARXVJESA-N |
| XLogP | -1.72 |
| TPSA | 169.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|