C14H14Cl2FNO — CID 176997121
(E)-1-[(3R)-3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 176997121) has the molecular formula C14H14Cl2FNO and a molecular weight of 302.18 g/mol. Its IUPAC name is (E)-1-[(3R)-3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 176997121 |
| Molecular Formula | C14H14Cl2FNO |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (E)-1-[(3R)-3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CC[C@H](c2c(F)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C14H14Cl2FNO/c1-2-3-12(19)18-7-6-9(8-18)13-11(17)5-4-10(15)14(13)16/h2-5,9H,6-8H2,1H3/b3-2+/t9-/m0/s1 |
| InChIKey | ORGYLEHIXTWJNN-HPOULIHZSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|