C25H28Cl2FN3O5 — CID 176997041
7-amino-2-(trihydroxymethyl)isoquinolin-1-one;1-[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-one;ethane (PubChem CID 176997041) has the molecular formula C25H28Cl2FN3O5 and a molecular weight of 540.42 g/mol. Its IUPAC name is 7-amino-2-(trihydroxymethyl)isoquinolin-1-one;1-[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-one;ethane.
| Compound Name | 7-amino-2-(trihydroxymethyl)isoquinolin-1-one;1-[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 176997041 |
| Molecular Formula | C25H28Cl2FN3O5 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 7-amino-2-(trihydroxymethyl)isoquinolin-1-one;1-[3-(2,3-dichloro-6-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-one;ethane |
| SMILES | C=CC(=O)N1CCC(c2c(F)ccc(Cl)c2Cl)C1.CC.Nc1ccc2ccn(C(O)(O)O)c(=O)c2c1 |
| InChI | InChI=1S/C13H12Cl2FNO.C10H10N2O4.C2H6/c1-2-11(18)17-6-5-8(7-17)12-10(16)4-3-9(14)13(12)15;11-7-2-1-6-3-4-12(10(14,15)16)9(13)8(6)5-7;1-2/h2-4,8H,1,5-7H2;1-5,14-16H,11H2;1-2H3 |
| InChIKey | BHJLWWIMJJDAST-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|