C19H18F4N2O2 — CID 152987796
6-fluoro-1-methyl-7-(1-prop-2-enoylpyrrolidin-3-yl)-2-(trifluoromethyl)-3H-indene-4-carboxamide (PubChem CID 152987796) has the molecular formula C19H18F4N2O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is 6-fluoro-1-methyl-7-(1-prop-2-enoylpyrrolidin-3-yl)-2-(trifluoromethyl)-3H-indene-4-carboxamide.
| Compound Name | 6-fluoro-1-methyl-7-(1-prop-2-enoylpyrrolidin-3-yl)-2-(trifluoromethyl)-3H-indene-4-carboxamide |
|---|---|
| PubChem CID | 152987796 |
| Molecular Formula | C19H18F4N2O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-fluoro-1-methyl-7-(1-prop-2-enoylpyrrolidin-3-yl)-2-(trifluoromethyl)-3H-indene-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(c2c(F)cc(C(N)=O)c3c2C(C)=C(C(F)(F)F)C3)C1 |
| InChI | InChI=1S/C19H18F4N2O2/c1-3-15(26)25-5-4-10(8-25)17-14(20)7-12(18(24)27)11-6-13(19(21,22)23)9(2)16(11)17/h3,7,10H,1,4-6,8H2,2H3,(H2,24,27) |
| InChIKey | UVQUBTATRUMMQS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|