C19H22FN3O3 — CID 159103268
6-fluoro-1,2-dimethyl-7-[methyl-[(3S)-1-oxaldehydoylpyrrolidin-3-yl]amino]-3H-indene-4-carboxamide (PubChem CID 159103268) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 6-fluoro-1,2-dimethyl-7-[methyl-[(3S)-1-oxaldehydoylpyrrolidin-3-yl]amino]-3H-indene-4-carboxamide.
| Compound Name | 6-fluoro-1,2-dimethyl-7-[methyl-[(3S)-1-oxaldehydoylpyrrolidin-3-yl]amino]-3H-indene-4-carboxamide |
|---|---|
| PubChem CID | 159103268 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-fluoro-1,2-dimethyl-7-[methyl-[(3S)-1-oxaldehydoylpyrrolidin-3-yl]amino]-3H-indene-4-carboxamide |
| SMILES | CC1=C(C)c2c(c(C(N)=O)cc(F)c2N(C)[C@H]2CCN(C(=O)C=O)C2)C1 |
| InChI | InChI=1S/C19H22FN3O3/c1-10-6-13-14(19(21)26)7-15(20)18(17(13)11(10)2)22(3)12-4-5-23(8-12)16(25)9-24/h7,9,12H,4-6,8H2,1-3H3,(H2,21,26)/t12-/m0/s1 |
| InChIKey | KDOAVFXDBDIEHV-LBPRGKRZSA-N |
| XLogP | 1.51 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|